C13H27NO — CID 64730061
N-[2-(3,5-dimethylcyclohexyl)oxyethyl]propan-2-amine (PubChem CID 64730061) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N-[2-(3,5-dimethylcyclohexyl)oxyethyl]propan-2-amine.
| Compound Name | N-[2-(3,5-dimethylcyclohexyl)oxyethyl]propan-2-amine |
|---|---|
| PubChem CID | 64730061 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-[2-(3,5-dimethylcyclohexyl)oxyethyl]propan-2-amine |
| SMILES | CC1CC(C)CC(OCCNC(C)C)C1 |
| InChI | InChI=1S/C13H27NO/c1-10(2)14-5-6-15-13-8-11(3)7-12(4)9-13/h10-14H,5-9H2,1-4H3 |
| InChIKey | TUBPSANXGBNWGC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|