C12H22F3NO — CID 64730184
3-(3,5-dimethylcyclohexyl)oxy-4,4,4-trifluorobutan-1-amine (PubChem CID 64730184) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-(3,5-dimethylcyclohexyl)oxy-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(3,5-dimethylcyclohexyl)oxy-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 64730184 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-(3,5-dimethylcyclohexyl)oxy-4,4,4-trifluorobutan-1-amine |
| SMILES | CC1CC(C)CC(OC(CCN)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H22F3NO/c1-8-5-9(2)7-10(6-8)17-11(3-4-16)12(13,14)15/h8-11H,3-7,16H2,1-2H3 |
| InChIKey | XDWCDQIPMJIRRM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |