About [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine
[4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine (PubChem CID 64730255) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine.
Molecular Properties
| Compound Name | [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine |
| PubChem CID | 64730255 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine |
| SMILES | CC1CC(C)CC(OCc2nnsc2NN)C1 |
| InChI | InChI=1S/C11H20N4OS/c1-7-3-8(2)5-9(4-7)16-6-10-11(13-12)17-15-14-10/h7-9,13H,3-6,12H2,1-2H3 |
| InChIKey | SXJFAMWDWRXCQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine?
The IUPAC name of [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine (CID 64730255) is [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine.
What is the SMILES notation for [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine?
The canonical SMILES for [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine is CC1CC(C)CC(OCc2nnsc2NN)C1.
What is the InChIKey of [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine?
The InChIKey is SXJFAMWDWRXCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-7-3-8(2)5-9(4-7)16-6-10-11(13-12)17-15-14-10/h7-9,13H,3-6,12H2,1-2H3.
What are the key properties of [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine?
[4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine has a molecular weight of 256.37 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,5-dimethylcyclohexyl)oxymethyl]thiadiazol-5-yl]hydrazine is sourced from PubChem (CID 64730255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).