About 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine
1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine (PubChem CID 64730271) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine |
| PubChem CID | 64730271 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine |
| SMILES | CC1CC(C)CC(N2C(C)CNCC2C)C1 |
| InChI | InChI=1S/C14H28N2/c1-10-5-11(2)7-14(6-10)16-12(3)8-15-9-13(16)4/h10-15H,5-9H2,1-4H3 |
| InChIKey | WOGWRQCVQSPAQZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine?
The IUPAC name of 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine (CID 64730271) is 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine.
What is the SMILES notation for 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine?
The canonical SMILES for 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine is CC1CC(C)CC(N2C(C)CNCC2C)C1.
What is the InChIKey of 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine?
The InChIKey is WOGWRQCVQSPAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-10-5-11(2)7-14(6-10)16-12(3)8-15-9-13(16)4/h10-15H,5-9H2,1-4H3.
What are the key properties of 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine?
1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine has a molecular weight of 224.39 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylcyclohexyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 64730271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).