C17H24O4 — CID 64730959
2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]benzoic acid (PubChem CID 64730959) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]benzoic acid.
| Compound Name | 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]benzoic acid |
|---|---|
| PubChem CID | 64730959 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]benzoic acid |
| SMILES | CC1CC(C)CC(OCCOc2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C17H24O4/c1-12-9-13(2)11-14(10-12)20-7-8-21-16-6-4-3-5-15(16)17(18)19/h3-6,12-14H,7-11H2,1-2H3,(H,18,19) |
| InChIKey | BKSVEGMSVMXUGT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|