About (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate
(3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate (PubChem CID 64731831) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate.
Molecular Properties
| Compound Name | (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate |
| PubChem CID | 64731831 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](N)C(=O)OC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H27NO2/c1-5-11(4)13(15)14(16)17-12-7-9(2)6-10(3)8-12/h9-13H,5-8,15H2,1-4H3/t9?,10?,11-,12?,13-/m0/s1 |
| InChIKey | ZWYSNVDHRDKYHJ-PQZGQSDKSA-N |
| XLogP | 2.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate?
The IUPAC name of (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate (CID 64731831) is (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate.
What is the SMILES notation for (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate?
The canonical SMILES for (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate is CC[C@H](C)[C@H](N)C(=O)OC1CC(C)CC(C)C1.
What is the InChIKey of (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate?
The InChIKey is ZWYSNVDHRDKYHJ-PQZGQSDKSA-N. The full InChI is InChI=1S/C14H27NO2/c1-5-11(4)13(15)14(16)17-12-7-9(2)6-10(3)8-12/h9-13H,5-8,15H2,1-4H3/t9?,10?,11-,12?,13-/m0/s1.
What are the key properties of (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate?
(3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate has a molecular weight of 241.37 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylcyclohexyl) (2S,3S)-2-amino-3-methylpentanoate is sourced from PubChem (CID 64731831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).