C14H14N2O2S — CID 6473256
3-(2-methylprop-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 6473256) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(2-methylprop-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 6473256 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-(2-methylprop-2-enoxy)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | C=C(C)COc1cccc(C(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C14H14N2O2S/c1-10(2)9-18-12-5-3-4-11(8-12)13(17)16-14-15-6-7-19-14/h3-8H,1,9H2,2H3,(H,15,16,17) |
| InChIKey | KOLFBCBHFHPGKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|