2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid

C13H24N2O3 — CID 64733515

IUPAC2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid
SMILESCCN(CC(=O)O)C(=O)NC1CC(C)CC(C)C1
InChIInChI=1S/C13H24N2O3/c1-4-15(8-12(16)17)13(18)14-11-6-9(2)5-10(3)7-11/h9-11H,4-8H2,1-3H3,(H,14,18)(H,16,17)
InChIKeyVIMUPWTYZPQRCM-UHFFFAOYSA-N
MW256.35 g/mol
LogP1.93
Rot. Bonds4

About 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid

2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid (PubChem CID 64733515) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid.

Molecular Properties

Compound Name2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid
PubChem CID64733515
Molecular FormulaC13H24N2O3
Molecular Weight256.35 g/mol
Exact Mass256.18
IUPAC Name2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid
SMILESCCN(CC(=O)O)C(=O)NC1CC(C)CC(C)C1
InChIInChI=1S/C13H24N2O3/c1-4-15(8-12(16)17)13(18)14-11-6-9(2)5-10(3)7-11/h9-11H,4-8H2,1-3H3,(H,14,18)(H,16,17)
InChIKeyVIMUPWTYZPQRCM-UHFFFAOYSA-N
XLogP1.93
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.35
LogP ≤ 51.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid?
The IUPAC name of 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid (CID 64733515) is 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid.
What is the SMILES notation for 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid?
The canonical SMILES for 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid is CCN(CC(=O)O)C(=O)NC1CC(C)CC(C)C1.
What is the InChIKey of 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid?
The InChIKey is VIMUPWTYZPQRCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-4-15(8-12(16)17)13(18)14-11-6-9(2)5-10(3)7-11/h9-11H,4-8H2,1-3H3,(H,14,18)(H,16,17).
What are the key properties of 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid?
2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid has a molecular weight of 256.35 g/mol, XLogP of 1.93, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylcyclohexyl)carbamoyl-ethylamino]acetic acid is sourced from PubChem (CID 64733515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).