C13H25NOS — CID 64734603
N-(3,5-dimethylcyclohexyl)-1-oxothian-4-amine (PubChem CID 64734603) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-1-oxothian-4-amine.
| Compound Name | N-(3,5-dimethylcyclohexyl)-1-oxothian-4-amine |
|---|---|
| PubChem CID | 64734603 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-1-oxothian-4-amine |
| SMILES | CC1CC(C)CC(NC2CCS(=O)CC2)C1 |
| InChI | InChI=1S/C13H25NOS/c1-10-7-11(2)9-13(8-10)14-12-3-5-16(15)6-4-12/h10-14H,3-9H2,1-2H3 |
| InChIKey | USHGDMHBOUUNLR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |