About [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol
[1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol (PubChem CID 64735025) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol |
| PubChem CID | 64735025 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol |
| SMILES | CC1CC(C)C(CN2CCC(CO)CC2)C(N)C1 |
| InChI | InChI=1S/C15H30N2O/c1-11-7-12(2)14(15(16)8-11)9-17-5-3-13(10-18)4-6-17/h11-15,18H,3-10,16H2,1-2H3 |
| InChIKey | JQAPFZMRUCXIDA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol?
The IUPAC name of [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol (CID 64735025) is [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol is CC1CC(C)C(CN2CCC(CO)CC2)C(N)C1.
What is the InChIKey of [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol?
The InChIKey is JQAPFZMRUCXIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-11-7-12(2)14(15(16)8-11)9-17-5-3-13(10-18)4-6-17/h11-15,18H,3-10,16H2,1-2H3.
What are the key properties of [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol?
[1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol has a molecular weight of 254.42 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-amino-4,6-dimethylcyclohexyl)methyl]piperidin-4-yl]methanol is sourced from PubChem (CID 64735025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).