C15H21Cl2NOS — CID 64735541
2-(2,5-dichlorophenyl)sulfinyl-N,3,5-trimethylcyclohexan-1-amine (PubChem CID 64735541) has the molecular formula C15H21Cl2NOS and a molecular weight of 334.31 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfinyl-N,3,5-trimethylcyclohexan-1-amine.
| Compound Name | 2-(2,5-dichlorophenyl)sulfinyl-N,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64735541 |
| Molecular Formula | C15H21Cl2NOS |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfinyl-N,3,5-trimethylcyclohexan-1-amine |
| SMILES | CNC1CC(C)CC(C)C1S(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H21Cl2NOS/c1-9-6-10(2)15(13(7-9)18-3)20(19)14-8-11(16)4-5-12(14)17/h4-5,8-10,13,15,18H,6-7H2,1-3H3 |
| InChIKey | SEILCHOZFDQHGD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |