About ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate
ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 6473612) has the molecular formula C17H22N4O4S
and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate |
| PubChem CID | 6473612 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)Nc2nc3ccc(OC)cc3s2)CC1 |
| InChI | InChI=1S/C17H22N4O4S/c1-3-25-17(23)21-8-6-20(7-9-21)11-15(22)19-16-18-13-5-4-12(24-2)10-14(13)26-16/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,19,22) |
| InChIKey | CWPFTFGRNIYCED-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate (CID 6473612) is ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(CC(=O)Nc2nc3ccc(OC)cc3s2)CC1.
What is the InChIKey of ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate?
The InChIKey is CWPFTFGRNIYCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O4S/c1-3-25-17(23)21-8-6-20(7-9-21)11-15(22)19-16-18-13-5-4-12(24-2)10-14(13)26-16/h4-5,10H,3,6-9,11H2,1-2H3,(H,18,19,22).
What are the key properties of ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate?
ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate has a molecular weight of 378.45 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxylate is sourced from PubChem (CID 6473612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).