C17H26O2 — CID 64736309
(1R)-1-[4-(3,5-dimethylcyclohexyl)oxyphenyl]propan-1-ol (PubChem CID 64736309) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (1R)-1-[4-(3,5-dimethylcyclohexyl)oxyphenyl]propan-1-ol.
| Compound Name | (1R)-1-[4-(3,5-dimethylcyclohexyl)oxyphenyl]propan-1-ol |
|---|---|
| PubChem CID | 64736309 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (1R)-1-[4-(3,5-dimethylcyclohexyl)oxyphenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccc(OC2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C17H26O2/c1-4-17(18)14-5-7-15(8-6-14)19-16-10-12(2)9-13(3)11-16/h5-8,12-13,16-18H,4,9-11H2,1-3H3/t12?,13?,16?,17-/m1/s1 |
| InChIKey | MZSYUWDHUGPMTC-YAAHMLIESA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |