C14H17ClF2O3S — CID 64736683
4-(3,5-dimethylcyclohexyl)oxy-2,3-difluorobenzenesulfonyl chloride (PubChem CID 64736683) has the molecular formula C14H17ClF2O3S and a molecular weight of 338.80 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohexyl)oxy-2,3-difluorobenzenesulfonyl chloride.
| Compound Name | 4-(3,5-dimethylcyclohexyl)oxy-2,3-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 64736683 |
| Molecular Formula | C14H17ClF2O3S |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-(3,5-dimethylcyclohexyl)oxy-2,3-difluorobenzenesulfonyl chloride |
| SMILES | CC1CC(C)CC(Oc2ccc(S(=O)(=O)Cl)c(F)c2F)C1 |
| InChI | InChI=1S/C14H17ClF2O3S/c1-8-5-9(2)7-10(6-8)20-11-3-4-12(21(15,18)19)14(17)13(11)16/h3-4,8-10H,5-7H2,1-2H3 |
| InChIKey | NWMXBXRSIUWTER-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |