C19H26N2O2S — CID 6473678
N-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1-sulfonamide (PubChem CID 6473678) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1-sulfonamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 6473678 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2cccc3ccccc23)CC(C)(C)N1 |
| InChI | InChI=1S/C19H26N2O2S/c1-18(2)12-15(13-19(3,4)21-18)20-24(22,23)17-11-7-9-14-8-5-6-10-16(14)17/h5-11,15,20-21H,12-13H2,1-4H3 |
| InChIKey | DPHMQZWOUZWJSV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |