About 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate
2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate (PubChem CID 6473783) has the molecular formula C21H44NO4P
and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate.
Molecular Properties
| Compound Name | 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate |
| PubChem CID | 6473783 |
| Molecular Formula | C21H44NO4P |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])OCC[NH2+]C |
| InChI | InChI=1S/C21H44NO4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25-27(23,24)26-21-19-22-2/h10-11,22H,3-9,12-21H2,1-2H3,(H,23,24)/b11-10- |
| InChIKey | AKYXHVVGMUYTQZ-KHPPLWFESA-N |
| XLogP | 4.72 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate?
The IUPAC name of 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate (CID 6473783) is 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate.
What is the SMILES notation for 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate?
The canonical SMILES for 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate is CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])OCC[NH2+]C.
What is the InChIKey of 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate?
The InChIKey is AKYXHVVGMUYTQZ-KHPPLWFESA-N. The full InChI is InChI=1S/C21H44NO4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-25-27(23,24)26-21-19-22-2/h10-11,22H,3-9,12-21H2,1-2H3,(H,23,24)/b11-10-.
What are the key properties of 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate?
2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate has a molecular weight of 405.56 g/mol, XLogP of 4.72, 21 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylazaniumyl)ethyl [(Z)-octadec-9-enyl] phosphate is sourced from PubChem (CID 6473783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).