About 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine
1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine (PubChem CID 64738046) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine |
| PubChem CID | 64738046 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine |
| SMILES | CC1CCC(C(N)CC(C)(C)C)CC1C |
| InChI | InChI=1S/C14H29N/c1-10-6-7-12(8-11(10)2)13(15)9-14(3,4)5/h10-13H,6-9,15H2,1-5H3 |
| InChIKey | URCDZIWHBNORFT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine?
The IUPAC name of 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine (CID 64738046) is 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine.
What is the SMILES notation for 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine?
The canonical SMILES for 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine is CC1CCC(C(N)CC(C)(C)C)CC1C.
What is the InChIKey of 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine?
The InChIKey is URCDZIWHBNORFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-10-6-7-12(8-11(10)2)13(15)9-14(3,4)5/h10-13H,6-9,15H2,1-5H3.
What are the key properties of 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine?
1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine has a molecular weight of 211.39 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylcyclohexyl)-3,3-dimethylbutan-1-amine is sourced from PubChem (CID 64738046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).