C13H23NO — CID 64738365
1-(3,4-dimethylcyclohexyl)piperidin-4-one (PubChem CID 64738365) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)piperidin-4-one.
| Compound Name | 1-(3,4-dimethylcyclohexyl)piperidin-4-one |
|---|---|
| PubChem CID | 64738365 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)piperidin-4-one |
| SMILES | CC1CCC(N2CCC(=O)CC2)CC1C |
| InChI | InChI=1S/C13H23NO/c1-10-3-4-12(9-11(10)2)14-7-5-13(15)6-8-14/h10-12H,3-9H2,1-2H3 |
| InChIKey | FCCPJIXDJHTCSL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |