About N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine
N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine (PubChem CID 64738448) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| PubChem CID | 64738448 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNCC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C12H25N/c1-4-7-13-9-12-6-5-10(2)11(3)8-12/h10-13H,4-9H2,1-3H3 |
| InChIKey | ZPTPPVVIHHDXSR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The IUPAC name of N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine (CID 64738448) is N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
What is the SMILES notation for N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The canonical SMILES for N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine is CCCNCC1CCC(C)C(C)C1.
What is the InChIKey of N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The InChIKey is ZPTPPVVIHHDXSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-4-7-13-9-12-6-5-10(2)11(3)8-12/h10-13H,4-9H2,1-3H3.
What are the key properties of N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine has a molecular weight of 183.34 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethylcyclohexyl)methyl]propan-1-amine is sourced from PubChem (CID 64738448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).