About 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol
4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol (PubChem CID 64738452) has the molecular formula C19H26O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol |
| PubChem CID | 64738452 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol |
| SMILES | Cc1cc(C#CCCO)ccc1OC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C19H26O2/c1-14-7-9-18(13-15(14)2)21-19-10-8-17(12-16(19)3)6-4-5-11-20/h8,10,12,14-15,18,20H,5,7,9,11,13H2,1-3H3 |
| InChIKey | PCTAYMSZUUNYHQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol?
The IUPAC name of 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol (CID 64738452) is 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol.
What is the SMILES notation for 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol?
The canonical SMILES for 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol is Cc1cc(C#CCCO)ccc1OC1CCC(C)C(C)C1.
What is the InChIKey of 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol?
The InChIKey is PCTAYMSZUUNYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O2/c1-14-7-9-18(13-15(14)2)21-19-10-8-17(12-16(19)3)6-4-5-11-20/h8,10,12,14-15,18,20H,5,7,9,11,13H2,1-3H3.
What are the key properties of 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol?
4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol has a molecular weight of 286.42 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-dimethylcyclohexyl)oxy-3-methylphenyl]but-3-yn-1-ol is sourced from PubChem (CID 64738452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).