About potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide
potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide (PubChem CID 64738992) has the molecular formula C13H18BF3KNO
and a molecular weight of 311.20 g/mol. Its IUPAC name is potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide.
Molecular Properties
| Compound Name | potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide |
| PubChem CID | 64738992 |
| Molecular Formula | C13H18BF3KNO |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide |
| SMILES | CC1CCC(Oc2cncc([B-](F)(F)F)c2)CC1C.[K+] |
| InChI | InChI=1S/C13H18BF3NO.K/c1-9-3-4-12(5-10(9)2)19-13-6-11(7-18-8-13)14(15,16)17;/h6-10,12H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | FYUYNKZZJSOTCE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide?
The IUPAC name of potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide (CID 64738992) is potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide.
What is the SMILES notation for potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide?
The canonical SMILES for potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide is CC1CCC(Oc2cncc([B-](F)(F)F)c2)CC1C.[K+].
What is the InChIKey of potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide?
The InChIKey is FYUYNKZZJSOTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BF3NO.K/c1-9-3-4-12(5-10(9)2)19-13-6-11(7-18-8-13)14(15,16)17;/h6-10,12H,3-5H2,1-2H3;/q-1;+1.
What are the key properties of potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide?
potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide has a molecular weight of 311.20 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [5-(3,4-dimethylcyclohexyl)oxy-3-pyridinyl]-trifluoroboranuide is sourced from PubChem (CID 64738992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).