About (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol
(3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol (PubChem CID 64739213) has the molecular formula C15H20Cl2O
and a molecular weight of 287.23 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol |
| PubChem CID | 64739213 |
| Molecular Formula | C15H20Cl2O |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)c2cc(Cl)cc(Cl)c2)CC1C |
| InChI | InChI=1S/C15H20Cl2O/c1-9-3-4-11(5-10(9)2)15(18)12-6-13(16)8-14(17)7-12/h6-11,15,18H,3-5H2,1-2H3 |
| InChIKey | BVCMLRRIRCEAAP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol?
The IUPAC name of (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol (CID 64739213) is (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol.
What is the SMILES notation for (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol?
The canonical SMILES for (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol is CC1CCC(C(O)c2cc(Cl)cc(Cl)c2)CC1C.
What is the InChIKey of (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol?
The InChIKey is BVCMLRRIRCEAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2O/c1-9-3-4-11(5-10(9)2)15(18)12-6-13(16)8-14(17)7-12/h6-11,15,18H,3-5H2,1-2H3.
What are the key properties of (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol?
(3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol has a molecular weight of 287.23 g/mol, XLogP of 5.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)-(3,4-dimethylcyclohexyl)methanol is sourced from PubChem (CID 64739213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).