About 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine
1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine (PubChem CID 64740895) has the molecular formula C17H27FN2O
and a molecular weight of 294.41 g/mol. Its IUPAC name is 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine |
| PubChem CID | 64740895 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine |
| SMILES | CCCOc1cc(NC2CCC(C)C(C)C2)c(N)cc1F |
| InChI | InChI=1S/C17H27FN2O/c1-4-7-21-17-10-16(15(19)9-14(17)18)20-13-6-5-11(2)12(3)8-13/h9-13,20H,4-8,19H2,1-3H3 |
| InChIKey | BVNKTFIJOLQQHP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine?
The IUPAC name of 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine (CID 64740895) is 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine.
What is the SMILES notation for 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine?
The canonical SMILES for 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine is CCCOc1cc(NC2CCC(C)C(C)C2)c(N)cc1F.
What is the InChIKey of 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine?
The InChIKey is BVNKTFIJOLQQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FN2O/c1-4-7-21-17-10-16(15(19)9-14(17)18)20-13-6-5-11(2)12(3)8-13/h9-13,20H,4-8,19H2,1-3H3.
What are the key properties of 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine?
1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine has a molecular weight of 294.41 g/mol, XLogP of 4.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3,4-dimethylcyclohexyl)-4-fluoro-5-propoxybenzene-1,2-diamine is sourced from PubChem (CID 64740895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).