C17H26N2O — CID 64741348
(2R)-2-amino-N-(3,4-dimethylcyclohexyl)-3-phenylpropanamide (PubChem CID 64741348) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (2R)-2-amino-N-(3,4-dimethylcyclohexyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-(3,4-dimethylcyclohexyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 64741348 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2R)-2-amino-N-(3,4-dimethylcyclohexyl)-3-phenylpropanamide |
| SMILES | CC1CCC(NC(=O)[C@H](N)Cc2ccccc2)CC1C |
| InChI | InChI=1S/C17H26N2O/c1-12-8-9-15(10-13(12)2)19-17(20)16(18)11-14-6-4-3-5-7-14/h3-7,12-13,15-16H,8-11,18H2,1-2H3,(H,19,20)/t12?,13?,15?,16-/m1/s1 |
| InChIKey | HJGKAPSRVGIPBJ-NQMHXGEOSA-N |
| XLogP | 2.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |