About N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine
N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine (PubChem CID 64741879) has the molecular formula C18H32N2S
and a molecular weight of 308.54 g/mol. Its IUPAC name is N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine |
| PubChem CID | 64741879 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine |
| SMILES | Cc1nc(C(C)(C)C)sc1C(C)NC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C18H32N2S/c1-11-8-9-15(10-12(11)2)19-13(3)16-14(4)20-17(21-16)18(5,6)7/h11-13,15,19H,8-10H2,1-7H3 |
| InChIKey | HZDCQMOHMXCFCW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine?
The IUPAC name of N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine (CID 64741879) is N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine.
What is the SMILES notation for N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine?
The canonical SMILES for N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine is Cc1nc(C(C)(C)C)sc1C(C)NC1CCC(C)C(C)C1.
What is the InChIKey of N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine?
The InChIKey is HZDCQMOHMXCFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2S/c1-11-8-9-15(10-12(11)2)19-13(3)16-14(4)20-17(21-16)18(5,6)7/h11-13,15,19H,8-10H2,1-7H3.
What are the key properties of N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine?
N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine has a molecular weight of 308.54 g/mol, XLogP of 5.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dimethylcyclohexan-1-amine is sourced from PubChem (CID 64741879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).