About 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one
4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one (PubChem CID 6474289) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one.
Molecular Properties
| Compound Name | 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one |
| PubChem CID | 6474289 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one |
| SMILES | O=c1occ(/C=C\C2=NCCS2)c2ccccc12 |
| InChI | InChI=1S/C14H11NO2S/c16-14-12-4-2-1-3-11(12)10(9-17-14)5-6-13-15-7-8-18-13/h1-6,9H,7-8H2/b6-5- |
| InChIKey | STJYZXIVZMDPBP-WAYWQWQTSA-N |
| XLogP | 2.95 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one?
The IUPAC name of 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one (CID 6474289) is 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one.
What is the SMILES notation for 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one?
The canonical SMILES for 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one is O=c1occ(/C=C\C2=NCCS2)c2ccccc12.
What is the InChIKey of 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one?
The InChIKey is STJYZXIVZMDPBP-WAYWQWQTSA-N. The full InChI is InChI=1S/C14H11NO2S/c16-14-12-4-2-1-3-11(12)10(9-17-14)5-6-13-15-7-8-18-13/h1-6,9H,7-8H2/b6-5-.
What are the key properties of 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one?
4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one has a molecular weight of 257.31 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-2-(4,5-dihydro-1,3-thiazol-2-yl)ethenyl]isochromen-1-one is sourced from PubChem (CID 6474289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).