C18H19N5OS2 — CID 647429
2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 647429) has the molecular formula C18H19N5OS2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 647429 |
| Molecular Formula | C18H19N5OS2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cn1c(SCC(=O)Nc2nc3c(s2)CCCC3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H19N5OS2/c1-23-16(12-7-3-2-4-8-12)21-22-18(23)25-11-15(24)20-17-19-13-9-5-6-10-14(13)26-17/h2-4,7-8H,5-6,9-11H2,1H3,(H,19,20,24) |
| InChIKey | JHXXGPOLXINQSW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |