About [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine
[3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine (PubChem CID 64744334) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine.
Molecular Properties
| Compound Name | [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine |
| PubChem CID | 64744334 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine |
| SMILES | CC1CCC(OCCCOc2cccc(CN)c2)CC1C |
| InChI | InChI=1S/C18H29NO2/c1-14-7-8-18(11-15(14)2)21-10-4-9-20-17-6-3-5-16(12-17)13-19/h3,5-6,12,14-15,18H,4,7-11,13,19H2,1-2H3 |
| InChIKey | IRSPCJQTIINGEA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine?
The IUPAC name of [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine (CID 64744334) is [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine.
What is the SMILES notation for [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine?
The canonical SMILES for [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine is CC1CCC(OCCCOc2cccc(CN)c2)CC1C.
What is the InChIKey of [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine?
The InChIKey is IRSPCJQTIINGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-14-7-8-18(11-15(14)2)21-10-4-9-20-17-6-3-5-16(12-17)13-19/h3,5-6,12,14-15,18H,4,7-11,13,19H2,1-2H3.
What are the key properties of [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine?
[3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine has a molecular weight of 291.44 g/mol, XLogP of 3.76, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(3,4-dimethylcyclohexyl)oxypropoxy]phenyl]methanamine is sourced from PubChem (CID 64744334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).