About 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide
1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide (PubChem CID 647445) has the molecular formula C20H28N4O2
and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide |
| PubChem CID | 647445 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCCC(C(=O)NC(C)CCc3ccco3)C2)n1 |
| InChI | InChI=1S/C20H28N4O2/c1-14(8-9-18-7-5-11-26-18)21-19(25)17-6-4-10-24(13-17)20-22-15(2)12-16(3)23-20/h5,7,11-12,14,17H,4,6,8-10,13H2,1-3H3,(H,21,25) |
| InChIKey | UPGSNVHJRSGDKA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide (CID 647445) is 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide is Cc1cc(C)nc(N2CCCC(C(=O)NC(C)CCc3ccco3)C2)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide?
The InChIKey is UPGSNVHJRSGDKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2/c1-14(8-9-18-7-5-11-26-18)21-19(25)17-6-4-10-24(13-17)20-22-15(2)12-16(3)23-20/h5,7,11-12,14,17H,4,6,8-10,13H2,1-3H3,(H,21,25).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide?
1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide has a molecular weight of 356.47 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(furan-2-yl)butan-2-yl]piperidine-3-carboxamide is sourced from PubChem (CID 647445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).