About 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid
4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid (PubChem CID 64746105) has the molecular formula C15H18F2O3
and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid |
| PubChem CID | 64746105 |
| Molecular Formula | C15H18F2O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid |
| SMILES | CC1CCC(Oc2c(F)cc(C(=O)O)cc2F)CC1C |
| InChI | InChI=1S/C15H18F2O3/c1-8-3-4-11(5-9(8)2)20-14-12(16)6-10(15(18)19)7-13(14)17/h6-9,11H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | NYQBVAGJBRUBSK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid?
The IUPAC name of 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid (CID 64746105) is 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid?
The canonical SMILES for 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid is CC1CCC(Oc2c(F)cc(C(=O)O)cc2F)CC1C.
What is the InChIKey of 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid?
The InChIKey is NYQBVAGJBRUBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2O3/c1-8-3-4-11(5-9(8)2)20-14-12(16)6-10(15(18)19)7-13(14)17/h6-9,11H,3-5H2,1-2H3,(H,18,19).
What are the key properties of 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid?
4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid has a molecular weight of 284.30 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylcyclohexyl)oxy-3,5-difluorobenzoic acid is sourced from PubChem (CID 64746105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).