C35H36O6 — CID 6474656
[(5E,7E,9E,18E,20E,22E,25E)-14,27-diacetyloxynonacosa-5,7,9,18,20,22,25-heptaen-1,12,15,28-tetrayn-3-yl] acetate (PubChem CID 6474656) has the molecular formula C35H36O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is [(5E,7E,9E,18E,20E,22E,25E)-14,27-diacetyloxynonacosa-5,7,9,18,20,22,25-heptaen-1,12,15,28-tetrayn-3-yl] acetate.
| Compound Name | [(5E,7E,9E,18E,20E,22E,25E)-14,27-diacetyloxynonacosa-5,7,9,18,20,22,25-heptaen-1,12,15,28-tetrayn-3-yl] acetate |
|---|---|
| PubChem CID | 6474656 |
| Molecular Formula | C35H36O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | [(5E,7E,9E,18E,20E,22E,25E)-14,27-diacetyloxynonacosa-5,7,9,18,20,22,25-heptaen-1,12,15,28-tetrayn-3-yl] acetate |
| SMILES | C#CC(/C=C/C/C=C/C=C/C=C/CC#CC(C#CC/C=C/C=C/C=C/CC(C#C)OC(C)=O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C35H36O6/c1-6-33(39-30(3)36)26-22-18-14-10-8-9-11-16-20-24-28-35(41-32(5)38)29-25-21-17-13-12-15-19-23-27-34(7-2)40-31(4)37/h1-2,8-17,19,22-23,26,33-35H,18,20-21,27H2,3-5H3/b9-8+,14-10+,15-12+,16-11+,17-13+,23-19+,26-22+ |
| InChIKey | RHYRAAUUQAEZRB-PPMRZHSFSA-N |
| XLogP | 5.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|