C16H31NO — CID 64747111
2-(3,4-dimethylcyclohexyl)oxycyclooctan-1-amine (PubChem CID 64747111) has the molecular formula C16H31NO and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)oxycyclooctan-1-amine.
| Compound Name | 2-(3,4-dimethylcyclohexyl)oxycyclooctan-1-amine |
|---|---|
| PubChem CID | 64747111 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)oxycyclooctan-1-amine |
| SMILES | CC1CCC(OC2CCCCCCC2N)CC1C |
| InChI | InChI=1S/C16H31NO/c1-12-9-10-14(11-13(12)2)18-16-8-6-4-3-5-7-15(16)17/h12-16H,3-11,17H2,1-2H3 |
| InChIKey | NBQWDZHMRXGOAL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |