C14H27NO — CID 64747200
3,4-dimethyl-N-(oxan-3-ylmethyl)cyclohexan-1-amine (PubChem CID 64747200) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 3,4-dimethyl-N-(oxan-3-ylmethyl)cyclohexan-1-amine.
| Compound Name | 3,4-dimethyl-N-(oxan-3-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64747200 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 3,4-dimethyl-N-(oxan-3-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1CCC(NCC2CCCOC2)CC1C |
| InChI | InChI=1S/C14H27NO/c1-11-5-6-14(8-12(11)2)15-9-13-4-3-7-16-10-13/h11-15H,3-10H2,1-2H3 |
| InChIKey | QCJCQXHKNIUNLR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |