About (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one
(2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 6474892) has the molecular formula C16H12O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one |
| PubChem CID | 6474892 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)Cc2ccccc21 |
| InChI | InChI=1S/C16H12O3/c17-14-6-5-10(8-15(14)18)7-12-9-11-3-1-2-4-13(11)16(12)19/h1-8,17-18H,9H2/b12-7+ |
| InChIKey | PPOMQCAGVJQMEO-KPKJPENVSA-N |
| XLogP | 2.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one?
The IUPAC name of (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one (CID 6474892) is (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one.
What is the SMILES notation for (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one?
The canonical SMILES for (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one is O=C1/C(=C/c2ccc(O)c(O)c2)Cc2ccccc21.
What is the InChIKey of (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one?
The InChIKey is PPOMQCAGVJQMEO-KPKJPENVSA-N. The full InChI is InChI=1S/C16H12O3/c17-14-6-5-10(8-15(14)18)7-12-9-11-3-1-2-4-13(11)16(12)19/h1-8,17-18H,9H2/b12-7+.
What are the key properties of (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one?
(2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one has a molecular weight of 252.27 g/mol, XLogP of 2.92, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(3,4-dihydroxyphenyl)methylidene]-3H-inden-1-one is sourced from PubChem (CID 6474892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).