C18H22O2 — CID 64748926
[2-(4-methylcyclohexyl)oxynaphthalen-1-yl]methanol (PubChem CID 64748926) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [2-(4-methylcyclohexyl)oxynaphthalen-1-yl]methanol.
| Compound Name | [2-(4-methylcyclohexyl)oxynaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 64748926 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [2-(4-methylcyclohexyl)oxynaphthalen-1-yl]methanol |
| SMILES | CC1CCC(Oc2ccc3ccccc3c2CO)CC1 |
| InChI | InChI=1S/C18H22O2/c1-13-6-9-15(10-7-13)20-18-11-8-14-4-2-3-5-16(14)17(18)12-19/h2-5,8,11,13,15,19H,6-7,9-10,12H2,1H3 |
| InChIKey | PUKRJTPMCOIYMD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |