About 5-benzyl-4,6-dimethylpyrimidin-2-amine
5-benzyl-4,6-dimethylpyrimidin-2-amine (PubChem CID 647495) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-benzyl-4,6-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-benzyl-4,6-dimethylpyrimidin-2-amine |
| PubChem CID | 647495 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-benzyl-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C13H15N3/c1-9-12(10(2)16-13(14)15-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H2,14,15,16) |
| InChIKey | OOXQQUJJUAIJJC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-4,6-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-4,6-dimethylpyrimidin-2-amine?
The IUPAC name of 5-benzyl-4,6-dimethylpyrimidin-2-amine (CID 647495) is 5-benzyl-4,6-dimethylpyrimidin-2-amine.
What is the SMILES notation for 5-benzyl-4,6-dimethylpyrimidin-2-amine?
The canonical SMILES for 5-benzyl-4,6-dimethylpyrimidin-2-amine is Cc1nc(N)nc(C)c1Cc1ccccc1.
What is the InChIKey of 5-benzyl-4,6-dimethylpyrimidin-2-amine?
The InChIKey is OOXQQUJJUAIJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c1-9-12(10(2)16-13(14)15-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H2,14,15,16).
What are the key properties of 5-benzyl-4,6-dimethylpyrimidin-2-amine?
5-benzyl-4,6-dimethylpyrimidin-2-amine has a molecular weight of 213.28 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-4,6-dimethylpyrimidin-2-amine is sourced from PubChem (CID 647495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).