About N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine
N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine (PubChem CID 64749659) has the molecular formula C17H28N2
and a molecular weight of 260.42 g/mol. Its IUPAC name is N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine |
| PubChem CID | 64749659 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine |
| SMILES | Cc1ccccc1N(CCCN)C1CCC(C)CC1 |
| InChI | InChI=1S/C17H28N2/c1-14-8-10-16(11-9-14)19(13-5-12-18)17-7-4-3-6-15(17)2/h3-4,6-7,14,16H,5,8-13,18H2,1-2H3 |
| InChIKey | MYCLNRYOQZZYJI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine?
The IUPAC name of N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine (CID 64749659) is N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine.
What is the SMILES notation for N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine?
The canonical SMILES for N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine is Cc1ccccc1N(CCCN)C1CCC(C)CC1.
What is the InChIKey of N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine?
The InChIKey is MYCLNRYOQZZYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-14-8-10-16(11-9-14)19(13-5-12-18)17-7-4-3-6-15(17)2/h3-4,6-7,14,16H,5,8-13,18H2,1-2H3.
What are the key properties of N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine?
N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine has a molecular weight of 260.42 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-methylcyclohexyl)-N'-(2-methylphenyl)propane-1,3-diamine is sourced from PubChem (CID 64749659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).