C17H24O3 — CID 6475017
(9Z)-heptadeca-1,9-dien-4,6-diyne-3,8,11-triol (PubChem CID 6475017) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (9Z)-heptadeca-1,9-dien-4,6-diyne-3,8,11-triol.
| Compound Name | (9Z)-heptadeca-1,9-dien-4,6-diyne-3,8,11-triol |
|---|---|
| PubChem CID | 6475017 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (9Z)-heptadeca-1,9-dien-4,6-diyne-3,8,11-triol |
| SMILES | C=CC(O)C#CC#CC(O)/C=C\C(O)CCCCCC |
| InChI | InChI=1S/C17H24O3/c1-3-5-6-7-11-16(19)13-14-17(20)12-9-8-10-15(18)4-2/h4,13-20H,2-3,5-7,11H2,1H3/b14-13- |
| InChIKey | VAHRGQLBSHWDKX-YPKPFQOOSA-N |
| XLogP | 1.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|