C7H15NO5 — CID 6475028
(2R,3R,5S,6S)-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 6475028) has the molecular formula C7H15NO5 and a molecular weight of 193.20 g/mol. Its IUPAC name is (2R,3R,5S,6S)-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,5S,6S)-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 6475028 |
| Molecular Formula | C7H15NO5 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (2R,3R,5S,6S)-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1N[C@H](CO)[C@@H](O)C(O)[C@H]1O |
| InChI | InChI=1S/C7H15NO5/c9-1-3-5(11)7(13)6(12)4(2-10)8-3/h3-13H,1-2H2/t3-,4+,5-,6+,7? |
| InChIKey | CLVUFWXGNIFGNC-WAHCGKIUSA-N |
| XLogP | -3.61 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |