C14H28N2O — CID 64750376
2-amino-N-(3-ethylcyclohexyl)-4-methylpentanamide (PubChem CID 64750376) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-amino-N-(3-ethylcyclohexyl)-4-methylpentanamide.
| Compound Name | 2-amino-N-(3-ethylcyclohexyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 64750376 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-amino-N-(3-ethylcyclohexyl)-4-methylpentanamide |
| SMILES | CCC1CCCC(NC(=O)C(N)CC(C)C)C1 |
| InChI | InChI=1S/C14H28N2O/c1-4-11-6-5-7-12(9-11)16-14(17)13(15)8-10(2)3/h10-13H,4-9,15H2,1-3H3,(H,16,17) |
| InChIKey | JXFVDQFVSGLSII-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |