C16H16O4 — CID 6475132
methyl (2Z,8Z)-10-[(E)-2-methylbut-2-enoyl]oxydeca-2,8-dien-4,6-diynoate (PubChem CID 6475132) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (2Z,8Z)-10-[(E)-2-methylbut-2-enoyl]oxydeca-2,8-dien-4,6-diynoate.
| Compound Name | methyl (2Z,8Z)-10-[(E)-2-methylbut-2-enoyl]oxydeca-2,8-dien-4,6-diynoate |
|---|---|
| PubChem CID | 6475132 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | methyl (2Z,8Z)-10-[(E)-2-methylbut-2-enoyl]oxydeca-2,8-dien-4,6-diynoate |
| SMILES | C/C=C(\C)C(=O)OC/C=C\C#CC#C/C=C\C(=O)OC |
| InChI | InChI=1S/C16H16O4/c1-4-14(2)16(18)20-13-11-9-7-5-6-8-10-12-15(17)19-3/h4,9-12H,13H2,1-3H3/b11-9-,12-10-,14-4+ |
| InChIKey | BYGJMPLSVFUVSR-RXEUAHTNSA-N |
| XLogP | 1.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|