About 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol
2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol (PubChem CID 64751700) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol |
| PubChem CID | 64751700 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol |
| SMILES | COCCOC1C(C)CC(C)CC1O |
| InChI | InChI=1S/C11H22O3/c1-8-6-9(2)11(10(12)7-8)14-5-4-13-3/h8-12H,4-7H2,1-3H3 |
| InChIKey | AEURZLXIUWBLTC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol?
The IUPAC name of 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol (CID 64751700) is 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol.
What is the SMILES notation for 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol?
The canonical SMILES for 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol is COCCOC1C(C)CC(C)CC1O.
What is the InChIKey of 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol?
The InChIKey is AEURZLXIUWBLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-8-6-9(2)11(10(12)7-8)14-5-4-13-3/h8-12H,4-7H2,1-3H3.
What are the key properties of 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol?
2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol has a molecular weight of 202.29 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)-3,5-dimethylcyclohexan-1-ol is sourced from PubChem (CID 64751700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).