C16H21ClN2O — CID 64751941
6-chloro-5-[(3,5-dimethylcyclohexyl)amino]-1,3-dihydroindol-2-one (PubChem CID 64751941) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 6-chloro-5-[(3,5-dimethylcyclohexyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[(3,5-dimethylcyclohexyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 64751941 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 6-chloro-5-[(3,5-dimethylcyclohexyl)amino]-1,3-dihydroindol-2-one |
| SMILES | CC1CC(C)CC(Nc2cc3c(cc2Cl)NC(=O)C3)C1 |
| InChI | InChI=1S/C16H21ClN2O/c1-9-3-10(2)5-12(4-9)18-15-6-11-7-16(20)19-14(11)8-13(15)17/h6,8-10,12,18H,3-5,7H2,1-2H3,(H,19,20) |
| InChIKey | HZSYKCORZWAGGG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |