C15H20F3NO — CID 64751977
3,5-dimethyl-2-[2-(trifluoromethyl)phenoxy]cyclohexan-1-amine (PubChem CID 64751977) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,5-dimethyl-2-[2-(trifluoromethyl)phenoxy]cyclohexan-1-amine.
| Compound Name | 3,5-dimethyl-2-[2-(trifluoromethyl)phenoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 64751977 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3,5-dimethyl-2-[2-(trifluoromethyl)phenoxy]cyclohexan-1-amine |
| SMILES | CC1CC(C)C(Oc2ccccc2C(F)(F)F)C(N)C1 |
| InChI | InChI=1S/C15H20F3NO/c1-9-7-10(2)14(12(19)8-9)20-13-6-4-3-5-11(13)15(16,17)18/h3-6,9-10,12,14H,7-8,19H2,1-2H3 |
| InChIKey | MQAFPXAPPIDGHC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |