C38H67NO7 — CID 6475201
(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid;octanoic acid (PubChem CID 6475201) has the molecular formula C38H67NO7 and a molecular weight of 649.95 g/mol. Its IUPAC name is (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid;octanoic acid.
| Compound Name | (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid;octanoic acid |
|---|---|
| PubChem CID | 6475201 |
| Molecular Formula | C38H67NO7 |
| Molecular Weight | 649.95 g/mol |
| Exact Mass | 649.49 |
| IUPAC Name | (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid;octanoic acid |
| SMILES | C/C=C/C/C=C/CCC(=O)[C@H]1O[C@H]1C(N)=O.CCCCCCCC(=O)O.CCCCCCCC/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C12H17NO3.C8H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15;1-2-3-4-5-6-7-8(9)10/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15);2-7H2,1H3,(H,9,10)/b10-9+;3-2+,6-5+;/t;10-,11-;/m.1./s1 |
| InChIKey | WSPUIVFSKPWUDC-DOIIMVITSA-N |
| XLogP | 9.65 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.95 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|