C36H65NO7 — CID 6475202
hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;octanoic acid (PubChem CID 6475202) has the molecular formula C36H65NO7 and a molecular weight of 623.92 g/mol. Its IUPAC name is hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;octanoic acid.
| Compound Name | hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;octanoic acid |
|---|---|
| PubChem CID | 6475202 |
| Molecular Formula | C36H65NO7 |
| Molecular Weight | 623.92 g/mol |
| Exact Mass | 623.48 |
| IUPAC Name | hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;octanoic acid |
| SMILES | C/C=C/C/C=C/CCC(=O)[C@H]1O[C@H]1C(N)=O.CCCCCCCC(=O)O.CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2.C12H17NO3.C8H16O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15;1-2-3-4-5-6-7-8(9)10/h2-15H2,1H3,(H,17,18);2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15);2-7H2,1H3,(H,9,10)/b;3-2+,6-5+;/t;10-,11-;/m.1./s1 |
| InChIKey | BTDFLLDORHWBFW-HMENRZOYSA-N |
| XLogP | 9.09 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.92 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|