About 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one
3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one (PubChem CID 64752407) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one |
| PubChem CID | 64752407 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one |
| SMILES | CC1CC(C)CC(Nc2ccc(-n3cc[nH]c3=O)cc2)C1 |
| InChI | InChI=1S/C17H23N3O/c1-12-9-13(2)11-15(10-12)19-14-3-5-16(6-4-14)20-8-7-18-17(20)21/h3-8,12-13,15,19H,9-11H2,1-2H3,(H,18,21) |
| InChIKey | RAFMCRGWJBLTHS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one?
The IUPAC name of 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one (CID 64752407) is 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one.
What is the SMILES notation for 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one?
The canonical SMILES for 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one is CC1CC(C)CC(Nc2ccc(-n3cc[nH]c3=O)cc2)C1.
What is the InChIKey of 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one?
The InChIKey is RAFMCRGWJBLTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-12-9-13(2)11-15(10-12)19-14-3-5-16(6-4-14)20-8-7-18-17(20)21/h3-8,12-13,15,19H,9-11H2,1-2H3,(H,18,21).
What are the key properties of 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one?
3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one has a molecular weight of 285.39 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,5-dimethylcyclohexyl)amino]phenyl]-1H-imidazol-2-one is sourced from PubChem (CID 64752407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).