C17H27NO2S — CID 64752881
2-(2,4-dimethylphenyl)sulfonyl-N,3,5-trimethylcyclohexan-1-amine (PubChem CID 64752881) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfonyl-N,3,5-trimethylcyclohexan-1-amine.
| Compound Name | 2-(2,4-dimethylphenyl)sulfonyl-N,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64752881 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfonyl-N,3,5-trimethylcyclohexan-1-amine |
| SMILES | CNC1CC(C)CC(C)C1S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C17H27NO2S/c1-11-6-7-16(13(3)8-11)21(19,20)17-14(4)9-12(2)10-15(17)18-5/h6-8,12,14-15,17-18H,9-10H2,1-5H3 |
| InChIKey | SQGHIMPBASXJOC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |