About 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine
1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64753679) has the molecular formula C16H31F3N2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine |
| PubChem CID | 64753679 |
| Molecular Formula | C16H31F3N2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCCCN(CCCC)C1(CN)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H31F3N2/c1-3-5-11-21(12-6-4-2)15(13-20)9-7-14(8-10-15)16(17,18)19/h14H,3-13,20H2,1-2H3 |
| InChIKey | LSRGTRYRYJNKSD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine?
The IUPAC name of 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine (CID 64753679) is 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine.
What is the SMILES notation for 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine?
The canonical SMILES for 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine is CCCCN(CCCC)C1(CN)CCC(C(F)(F)F)CC1.
What is the InChIKey of 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine?
The InChIKey is LSRGTRYRYJNKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31F3N2/c1-3-5-11-21(12-6-4-2)15(13-20)9-7-14(8-10-15)16(17,18)19/h14H,3-13,20H2,1-2H3.
What are the key properties of 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine?
1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine has a molecular weight of 308.43 g/mol, XLogP of 4.34, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-N,N-dibutyl-4-(trifluoromethyl)cyclohexan-1-amine is sourced from PubChem (CID 64753679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).