C9H16F3N — CID 64753806
2,5-dimethyl-1-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 64753806) has the molecular formula C9H16F3N and a molecular weight of 195.23 g/mol. Its IUPAC name is 2,5-dimethyl-1-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | 2,5-dimethyl-1-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64753806 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 2,5-dimethyl-1-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CC1CCC(C)C(N)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N/c1-6-3-4-7(2)8(13,5-6)9(10,11)12/h6-7H,3-5,13H2,1-2H3 |
| InChIKey | KIZSUQBGINOKLR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |